logo
Home  > Methyl 3-iodo-1h-pyrazolo[3,4-b]pyridine-5-carboxylate

AA55281

1221288-25-0 | Methyl 3-iodo-1h-pyrazolo[3,4-b]pyridine-5-carboxylate

Packsize Purity Availability Price Discounted Price    Quantity
100mg 95% in stock $26.00 $19.00 -   +
250mg 95% in stock $43.00 $31.00 -   +
1g 95% in stock $117.00 $82.00 -   +
2500mg 95% in stock $268.00 $188.00 -   +
5g 95% in stock $512.00 $358.00 -   +
25g 95% in stock $1,789.00 $1,252.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AA55281
Chemical Name: Methyl 3-iodo-1h-pyrazolo[3,4-b]pyridine-5-carboxylate
CAS Number: 1221288-25-0
Molecular Formula: C8H6IN3O2
Molecular Weight: 303.0566
MDL Number: MFCD17015947
SMILES: COC(=O)c1cc2c(I)n[nH]c2nc1

 

Upstream Synthesis Route 
  • Methyl 3-iodo-1H-pyrazolo[3,4-b]pyridine-5-carboxylate is a versatile compound widely used in chemical synthesis as a building block for the construction of complex molecules. This compound serves as a key intermediate in the synthesis of various pharmaceuticals, agrochemicals, and functional materials. Its strategic placement of functional groups makes it a valuable tool for introducing specific structural motifs into target molecules. Additionally, the unique reactivity of the iodo group allows for further derivatization, enabling the facile preparation of diverse molecular scaffolds. In organic synthesis, this compound is crucial for the creation of novel chemical entities with potential applications in drug discovery, materials science, and biotechnology.
FEATURED PRODUCTS