AE88187
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 97% | in stock | $100.00 | $70.00 | - + | |
250mg | 97% | in stock | $153.00 | $107.00 | - + | |
1g | 97% | in stock | $307.00 | $215.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE88187 |
Chemical Name: | Fmoc-l-homopro(4-oxo)-oh |
CAS Number: | 1221793-43-6 |
Molecular Formula: | C21H19NO5 |
Molecular Weight: | 365.37926000000004 |
MDL Number: | MFCD03094868 |
SMILES: | O=C1CCN([C@@H](C1)C(=O)O)C(=O)OCC1c2ccccc2-c2c1cccc2 |
Fmoc-L-Homopro(4-oxo) is a valuable building block in chemical synthesis, commonly used in peptide and small molecule synthesis. Its unique structure allows for versatile applications, particularly in the creation of complex peptides and compounds with specific functions.One key application of Fmoc-L-Homopro(4-oxo) is in solid-phase peptide synthesis (SPPS), where it serves as a key component for the selective deprotection and functionalization of amino acids. The Fmoc protecting group provides stability during the synthetic process, allowing for controlled and efficient peptide assembly. Additionally, the presence of the homoproline moiety introduces rigidity and conformational constraints to the peptide backbone, influencing the overall structure and biological activity of the peptide product.Furthermore, Fmoc-L-Homopro(4-oxo) can be incorporated into peptidomimetics and drug-like molecules to modulate their physicochemical properties and enhance their affinity for target biomolecules. Its incorporation can also influence the pharmacokinetic profile and therapeutic potential of the final compound.Overall, Fmoc-L-Homopro(4-oxo) is a versatile and indispensable tool in chemical synthesis, offering unique capabilities for the design and construction of diverse molecular architectures with applications spanning from basic research to drug discovery and development.