BA01712
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
10mg | 98% | in stock | $334.00 | $234.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | BA01712 |
Chemical Name: | [11]Cycloparaphenylene |
CAS Number: | 1222105-48-7 |
Molecular Formula: | C66H44 |
Molecular Weight: | 837.0556 |
SMILES: | c1cc2-c3ccc(-c4ccc(-c5ccc(-c6ccc(-c7ccc(-c8ccc(-c9ccc(-c%10ccc(-c%11ccc(-c%12ccc(-c1cc2)cc%12)cc%11)cc%10)cc9)cc8)cc7)cc6)cc5)cc4)cc3 |
[11]Cycloparaphenylene, a novel cyclic carbon nanoring, plays a pivotal role in modern chemical synthesis as a versatile building block. Its unique structure with a repeating para-phenylene unit provides it with distinct chemical properties, making it an invaluable tool in the creation of complex organic molecules.In chemical synthesis, [11]Cycloparaphenylene serves as a key precursor for the construction of various functional materials, such as conducting polymers, organic semiconductors, and molecular switches. Its cyclic nature allows for precise control over the spatial arrangement of atoms, facilitating the synthesis of highly ordered structures with specific properties.Additionally, the size and shape of [11]Cycloparaphenylene can be tailored to meet the requirements of different applications, making it a versatile building block for the design of advanced materials. Its rigid, π-conjugated framework enables efficient π-π stacking interactions, which are essential for the development of electronic devices and materials with desired optoelectronic properties.Overall, [11]Cycloparaphenylene represents a promising platform for the development of innovative materials and functional molecules in chemical synthesis, driving advancements in diverse fields such as organic electronics, supramolecular chemistry, and materials science.