logo
Home  > Pharmaceutical Intermediates  > Dermatological Agents  > Bepotastine   > 2-[(4-Chlorophenyl)(4-piperidinyloxy)methyl]pyridine

AA55742

122368-54-1 | 2-[(4-Chlorophenyl)(4-piperidinyloxy)methyl]pyridine

Packsize Purity Availability Price Discounted Price    Quantity
250mg 98% in stock $16.00 $11.00 -   +
1g 98% in stock $26.00 $18.00 -   +
5g 98% in stock $34.00 $24.00 -   +
25g 98% in stock $102.00 $71.00 -   +
100g 98% in stock $369.00 $258.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA55742
Chemical Name: 2-[(4-Chlorophenyl)(4-piperidinyloxy)methyl]pyridine
CAS Number: 122368-54-1
Molecular Formula: C17H19ClN2O
Molecular Weight: 302.7986
MDL Number: MFCD13184723
SMILES: Clc1ccc(cc1)C(c1ccccn1)OC1CCNCC1

 

Computed Properties
Complexity: 301  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 21  
Hydrogen Bond Acceptor Count: 3  
Hydrogen Bond Donor Count: 1  
Rotatable Bond Count: 4  
Undefined Atom Stereocenter Count: 1  
XLogP3: 3  

 

 

Upstream Synthesis Route
  • The organic compound 2-((4-Chlorophenyl)(piperidin-4-yloxy)methyl)pyridine plays a crucial role in chemical synthesis as a versatile building block. Due to its unique structure, this compound is frequently utilized in the synthesis of various pharmaceuticals, agrochemicals, and specialty chemicals. Its inclusion in synthetic routes allows for the efficient construction of complex molecular structures with specific biological or chemical activities. Additionally, the presence of both a piperidine moiety and a chlorophenyl group in its structure offers diverse functional groups for further derivatization, enabling the creation of novel compounds with enhanced properties and activities. In the realm of chemical synthesis, 2-((4-Chlorophenyl)(piperidin-4-yloxy)methyl)pyridine serves as a valuable intermediate that facilitates the development of new molecules with potential applications in various fields.
FEATURED PRODUCTS