AE34425
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $139.00 | $97.00 | - + | |
1g | 97% | in stock | $251.00 | $176.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE34425 |
Chemical Name: | BIS(CYCLOOCTENE)IRIDIUM(I) CHLORIDE, DIMER |
CAS Number: | 12246-51-4 |
Molecular Formula: | C32H56Cl2Ir2 |
Molecular Weight: | 896.127 |
MDL Number: | MFCD00213465 |
SMILES: | C1CCCC[CH]2=[CH](C1)[Ir+]132([Cl-][Ir+]24([Cl-]1)([CH]1=[CH]4CCCCCC1)[CH]1=[CH]2CCCCCC1)[CH]1=[CH]3CCCCCC1 |
The versatile compound Dichlorotetrakis(cyclooctene)diiridium serves as a powerful catalyst in various chemical synthesis processes. Its unique chemical properties make it an essential tool in organic synthesis, where it can facilitate numerous important reactions with high efficiency and selectivity. By acting as a catalyst, this compound can accelerate chemical reactions, leading to faster reaction rates and higher yields of desired products. Additionally, Dichlorotetrakis(cyclooctene)diiridium can enable the formation of complex molecular structures that might be challenging to achieve using traditional methods. Its role in catalysis makes it a valuable asset in the development of new molecules and materials for a wide range of applications.