logo
Home  > (R)-1-Cbz-3-boc-aminopyrrolidine

AA56061

122536-75-8 | (R)-1-Cbz-3-boc-aminopyrrolidine

Packsize Purity Availability Price Discounted Price    Quantity
1g 98% in stock $113.00 $79.00 -   +
5g 98% in stock $362.00 $254.00 -   +
10g 98% in stock $603.00 $422.00 -   +
25g 98% in stock $1,209.00 $846.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AA56061
Chemical Name: (R)-1-Cbz-3-boc-aminopyrrolidine
CAS Number: 122536-75-8
Molecular Formula: C17H24N2O4
Molecular Weight: 320.3835
MDL Number: MFCD08704349
SMILES: O=C(OC(C)(C)C)N[C@@H]1CCN(C1)C(=O)OCc1ccccc1

 

Upstream Synthesis Route 
  • The (R)-1-Cbz-3-Boc-Aminopyrrolidine molecule plays a crucial role in chemical synthesis, particularly in the field of pharmaceuticals and drug development. With its unique structure and properties, this compound serves as a versatile building block for various synthetic pathways. Its strategic incorporation in organic reactions allows for the selective formation of complex molecular structures, enhancing the efficiency and specificity of the synthesis process. (R)-1-Cbz-3-Boc-Aminopyrrolidine facilitates the construction of specialized molecules with potential therapeutic applications, making it an indispensable tool for researchers and chemists working in medicinal chemistry and drug discovery.
FEATURED PRODUCTS