AA56337
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $29.00 | $20.00 | - + | |
1g | 97% | in stock | $97.00 | $68.00 | - + | |
5g | 97% | in stock | $212.00 | $149.00 | - + | |
10g | 97% | in stock | $386.00 | $270.00 | - + | |
25g | 97% | in stock | $758.00 | $531.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA56337 |
Chemical Name: | tert-Butyl 2-(methylsulfonyl)-4,6-dihydropyrrolo[3,4-c]pyrazole-5(2h)-carboxylate |
CAS Number: | 1226781-82-3 |
Molecular Formula: | C11H17N3O4S |
Molecular Weight: | 287.3354 |
MDL Number: | MFCD24467621 |
SMILES: | O=C(N1Cc2c(C1)cn(n2)S(=O)(=O)C)OC(C)(C)C |
Complexity: | 465 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 19 |
Hydrogen Bond Acceptor Count: | 5 |
Rotatable Bond Count: | 3 |
XLogP3: | 0.2 |
The tert-Butyl 2-(methylsulfonyl)-4,6-dihydropyrrolo[3,4-c]pyrazole-5(2H)-carboxylate compound plays a crucial role in chemical synthesis as a versatile building block. It is commonly utilized in the preparation of various complex organic molecules through transformations such as nucleophilic addition reactions, substitution reactions, and cyclization processes. This compound serves as a key intermediate in the synthesis of pharmaceuticals, agrochemicals, and other functional materials due to its unique structural features and reactivity. Its incorporation in chemical reactions facilitates the formation of diverse molecular architectures and enables the efficient production of valuable compounds with enhanced properties and functionalities.