AA25065
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $8.00 | $5.00 | - + | |
1g | 95% | in stock | $9.00 | $6.00 | - + | |
5g | 95% | in stock | $40.00 | $28.00 | - + | |
10g | 95% | in stock | $76.00 | $53.00 | - + | |
25g | 95% | in stock | $121.00 | $85.00 | - + | |
100g | 95% | in stock | $386.00 | $270.00 | - + | |
500g | 95% | in stock | $1,317.00 | $922.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA25065 |
Chemical Name: | Ethyl 6-bromo-4-hydroxyquinoline-3-carboxylate |
CAS Number: | 122794-99-4 |
Molecular Formula: | C12H10BrNO3 |
Molecular Weight: | 296.1167 |
MDL Number: | MFCD00173362 |
SMILES: | CCOC(=O)c1cnc2c(c1O)cc(cc2)Br |
Complexity: | 367 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
XLogP3: | 2.7 |
Journal of medicinal chemistry 20060420