AA25413
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 99% | in stock | $17.00 | $12.00 | - + | |
5mg | 99% | in stock | $36.00 | $25.00 | - + | |
10mg | 99% | in stock | $51.00 | $36.00 | - + | |
50mg | 99% | in stock | $134.00 | $94.00 | - + | |
100mg | 99% | in stock | $225.00 | $157.00 | - + | |
250mg | 99% | in stock | $380.00 | $266.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA25413 |
Chemical Name: | GS-9973 |
CAS Number: | 1229208-44-9 |
Molecular Formula: | C23H21N7O |
Molecular Weight: | 411.4591 |
MDL Number: | MFCD28099806 |
SMILES: | O1CCN(CC1)c1ccc(cc1)Nc1nc(cn2c1ncc2)c1ccc2c(c1)[nH]nc2 |
Complexity: | 595 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 31 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 4 |
XLogP3: | 3.6 |
Journal of medicinal chemistry 20140508