AA27318
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $34.00 | $24.00 | - + | |
250mg | 95% | in stock | $46.00 | $32.00 | - + | |
1g | 95% | in stock | $49.00 | $35.00 | - + | |
2g | 95% | in stock | $93.00 | $66.00 | - + | |
5g | 95% | in stock | $226.00 | $159.00 | - + | |
10g | 95% | in stock | $442.00 | $310.00 | - + | |
25g | 95% | in stock | $1,105.00 | $774.00 | - + | |
100g | 95% | in stock | $3,525.00 | $2,468.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA27318 |
Chemical Name: | 6-Boc-2-hydroxy-6-aza-spiro[3.4]octane |
CAS Number: | 1239319-91-5 |
Molecular Formula: | C12H21NO3 |
Molecular Weight: | 227.3 |
MDL Number: | MFCD18073249 |
SMILES: | OC1CC2(C1)CCN(C2)C(=O)OC(C)(C)C |
Complexity: | 289 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 1.2 |
The tert-Butyl 2-hydroxy-6-azaspiro[3.4]octane-6-carboxylate plays a crucial role in chemical synthesis as a versatile building block. Its unique structure enables it to be used in various transformations to introduce functional groups or create diverse chemical compounds. In organic synthesis, this compound can serve as a key intermediate for the preparation of pharmaceuticals, agrochemicals, and advanced materials. With its spirocyclic nature, this compound offers opportunities for the development of biologically active molecules and complex organic frameworks. The tert-Butyl 2-hydroxy-6-azaspiro[3.4]octane-6-carboxylate is a valuable asset in the toolkit of synthetic chemists seeking to access novel chemical structures and explore new avenues in chemical research.