AA28156
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
50mg | 97% | in stock | $63.00 | $44.00 | - + | |
100mg | 97% | in stock | $100.00 | $70.00 | - + | |
250mg | 97% | in stock | $159.00 | $111.00 | - + | |
1g | 97% | in stock | $410.00 | $287.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA28156 |
Chemical Name: | 3-(Cyclopropylmethoxy)-4-hydroxybenzoic acid |
CAS Number: | 1243391-44-7 |
Molecular Formula: | C11H12O4 |
Molecular Weight: | 208.2106 |
MDL Number: | MFCD16999961 |
SMILES: | OC(=O)c1ccc(c(c1)OCC1CC1)O |
Complexity: | 237 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 4 |
XLogP3: | 2.2 |
3-(Cyclopropylmethoxy)-4-hydroxybenzoic acid, also known as $name$, is a versatile compound widely used in chemical synthesis. Its unique structure and properties make it an invaluable building block for the creation of a variety of organic molecules. In chemical synthesis, this compound is commonly employed as a key intermediate in the preparation of pharmaceuticals, agrochemicals, and fine chemicals. The cyclopropyl group imparts rigidity and stereochemical control to the molecules, while the hydroxybenzoic acid moiety serves as a versatile functional group for further modifications. By incorporating 3-(Cyclopropylmethoxy)-4-hydroxybenzoic acid into synthetic routes, chemists can access a diverse array of structurally complex and biologically active compounds, making it a valuable tool in the field of organic chemistry.