AA28334
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | ≥98% | in stock | $42.00 | $29.00 | - + | |
5mg | 95% | in stock | $122.00 | $85.00 | - + | |
10mg | 95% | in stock | $177.00 | $124.00 | - + | |
25mg | 95% | in stock | $237.00 | $166.00 | - + | |
50mg | 95% | in stock | $403.00 | $282.00 | - + | |
100mg | 95% | in stock | $683.00 | $478.00 | - + | |
250mg | 95% | in stock | $1,160.00 | $812.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA28334 |
Chemical Name: | Pirodavir |
CAS Number: | 124436-59-5 |
Molecular Formula: | C21H27N3O3 |
Molecular Weight: | 369.4574 |
MDL Number: | MFCD00866965 |
SMILES: | CCOC(=O)c1ccc(cc1)OCCC1CCN(CC1)c1ccc(nn1)C |
Complexity: | 446 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 27 |
Hydrogen Bond Acceptor Count: | 6 |
Rotatable Bond Count: | 8 |
XLogP3: | 3.7 |
Molecules (Basel, Switzerland) 20110426
Bioorganic & medicinal chemistry letters 20110201
Yao xue xue bao = Acta pharmaceutica Sinica 20100401
Bioorganic & medicinal chemistry 20090115
Antiviral chemistry & chemotherapy 20070101
Bioorganic & medicinal chemistry letters 20050415
Antimicrobial agents and chemotherapy 20040501
Journal of medicinal chemistry 20031009
Journal of medicinal chemistry 20030717
Antiviral research 20020801
Journal of medicinal chemistry 20020411
Archives of virology 20020401
Antimicrobial agents and chemotherapy 19991001
Journal of medicinal chemistry 19990408
Antimicrobial agents and chemotherapy 19920601
Antimicrobial agents and chemotherapy 19920101