logo
Home  > Chemistry  > Organic Building Blocks  > Fluorinated Building Blocks  > (Trans,trans)-4-(4-ethoxy-2,3-difluorophenyl)-4'-pentyl-1,1'-bi(cyclohexane)

AA29186

124728-81-0 | (Trans,trans)-4-(4-ethoxy-2,3-difluorophenyl)-4'-pentyl-1,1'-bi(cyclohexane)

Packsize Purity Availability Price Discounted Price    Quantity
250mg 95% in stock $8.00 $5.00 -   +
1g 95% in stock $13.00 $9.00 -   +
5g 95% in stock $25.00 $17.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA29186
Chemical Name: (Trans,trans)-4-(4-ethoxy-2,3-difluorophenyl)-4'-pentyl-1,1'-bi(cyclohexane)
CAS Number: 124728-81-0
Molecular Formula: C25H38F2O
Molecular Weight: 392.5654
MDL Number: MFCD11053404
SMILES: CCCCC[C@@H]1CC[C@H](CC1)[C@@H]1CC[C@H](CC1)c1ccc(c(c1F)F)OCC

 

Computed Properties
Complexity: 426  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 28  
Hydrogen Bond Acceptor Count: 3  
Rotatable Bond Count: 8  
XLogP3: 9.9  

 

 

Upstream Synthesis Route
  • trans,trans-4'-(4-Ethoxy-2,3-difluorophenyl)-4-pentyl-bicyclohexyl is a versatile compound that finds valuable application in chemical synthesis. This compound serves as a key building block in the creation of various organic compounds, especially in the development of pharmaceuticals, agrochemicals, and materials science.In chemical synthesis, trans,trans-4'-(4-Ethoxy-2,3-difluorophenyl)-4-pentyl-bicyclohexyl acts as a crucial intermediate that allows chemists to introduce specific functional groups, alter molecular structures, and enhance the properties of final products. Its unique structure and reactivity make it a valuable tool for modifying the physicochemical properties of target molecules, thereby facilitating the synthesis of new compounds with desired characteristics.Whether used as a catalyst, a precursor, or a reagent, trans,trans-4'-(4-Ethoxy-2,3-difluorophenyl)-4-pentyl-bicyclohexyl plays a significant role in the development of innovative chemical processes and the design of novel molecular architectures. Its presence in the synthesis pathway can lead to the creation of compounds with improved stability, potency, or selectivity, making it an indispensable component in the toolbox of synthetic chemists.
FEATURED PRODUCTS