AA29235
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $18.00 | $13.00 | - + | |
5g | 98% | in stock | $31.00 | $22.00 | - + | |
10g | 98% | in stock | $61.00 | $43.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA29235 |
Chemical Name: | Ethyl 2-(bis(2,2,2-trifluoroethoxy)phosphoryl)acetate |
CAS Number: | 124755-24-4 |
Molecular Formula: | C8H11F6O5P |
Molecular Weight: | 332.1341 |
MDL Number: | MFCD01318337 |
SMILES: | CCOC(=O)CP(=O)(OCC(F)(F)F)OCC(F)(F)F |
Complexity: | 343 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 20 |
Hydrogen Bond Acceptor Count: | 11 |
Rotatable Bond Count: | 8 |
XLogP3: | 2 |
Ethyl 2-(bis(2,2,2-trifluoroethoxy)phosphoryl)acetate is a versatile compound that finds significant application in modern chemical synthesis. As a phosphorus-containing reagent, it serves as a valuable building block in the design and creation of organic molecules with unique properties.In chemical synthesis, this compound can act as a phosphonylating agent, facilitating the introduction of phosphoryl groups into organic molecules. Its distinctive trifluoroethoxy groups provide enhanced reactivity and stability, making it particularly useful in the functionalization of various substrates.Additionally, Ethyl 2-(bis(2,2,2-trifluoroethoxy)phosphoryl)acetate can participate in cross-coupling reactions, allowing for the formation of complex molecular structures through the formation of new carbon-phosphorus bonds. This capability opens up avenues for the synthesis of diverse compounds with potential applications in pharmaceuticals, agrochemicals, and materials science.