AA29806
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 97% | in stock | $30.00 | $21.00 | - + | |
250mg | 97% | in stock | $50.00 | $35.00 | - + | |
500mg | 97% | in stock | $100.00 | $70.00 | - + | |
1g | 97% | in stock | $198.00 | $139.00 | - + | |
5g | 97% | in stock | $653.00 | $457.00 | - + | |
10g | 97% | in stock | $1,015.00 | $710.00 | - + | |
25g | 97% | in stock | $1,909.00 | $1,337.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA29806 |
Chemical Name: | tert-Butyl 8-oxo-2,7-diazaspiro[4.4]nonane-2-carboxylate |
CAS Number: | 1251009-03-6 |
Molecular Formula: | C12H20N2O3 |
Molecular Weight: | 240.2988 |
MDL Number: | MFCD14581194 |
SMILES: | O=C1NCC2(C1)CCN(C2)C(=O)OC(C)(C)C |
Complexity: | 348 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
Undefined Atom Stereocenter Count: | 1 |
XLogP3: | 0.4 |
Tert-Butyl 8-oxo-2,7-diazaspiro[4.4]nonane-2-carboxylate is a valuable compound used in chemical synthesis for its unique spirocyclic structure and versatile reactivity. Its spirocyclic framework makes it a useful building block in the synthesis of various biologically active molecules and pharmaceuticals. This compound can serve as a precursor in the construction of complex organic molecules, allowing for the incorporation of the tert-butyl group, the oxo functionality, and the spiro nitrogen-containing ring into the final product. The presence of the carboxylate moiety also provides a handle for further derivatization, enabling the introduction of additional functional groups for fine-tuning the properties of the end product. Overall, tert-Butyl 8-oxo-2,7-diazaspiro[4.4]nonane-2-carboxylate is a versatile intermediate in organic synthesis, offering a wide range of possibilities for the creation of novel compounds with potential applications in medicinal chemistry and materials science.