AA30040
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | in stock | $51.00 | $36.00 | - + | |
250mg | 98% | in stock | $80.00 | $56.00 | - + | |
1g | 98% | in stock | $237.00 | $166.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA30040 |
Chemical Name: | (S)-N-Fmoc-2-(5'-pentenyl)glycine |
CAS Number: | 1251904-51-4 |
Molecular Formula: | C23H25NO4 |
Molecular Weight: | 379.4489 |
MDL Number: | MFCD03094929 |
SMILES: | C=CCCCC[C@@H](C(=O)O)NC(=O)OCC1c2ccccc2-c2c1cccc2 |
Complexity: | 527 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 28 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 10 |
XLogP3: | 5 |
The (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)oct-7-enoic acid, which will be referred to as $name$, is a highly versatile compound frequently utilized in chemical synthesis. Its unique molecular structure and reactivity make it an indispensable tool for synthetic chemists across various industries.One key application of $name$ in chemical synthesis is as a chiral building block for the asymmetric synthesis of complex molecules. Due to the presence of a chiral center in its structure, $name$ can impart chirality to target compounds, enabling the production of enantiomerically pure substances. This is particularly valuable in the pharmaceutical industry, where the stereochemistry of a molecule can significantly impact its biological activity and pharmacological properties.Furthermore, the presence of functional groups in $name$, such as the carbamate and carboxylic acid moieties, allows for a range of chemical transformations, including amidation, esterification, and peptide coupling reactions. These versatile functional groups enable the incorporation of $name$ into diverse molecular frameworks, enhancing the synthetic flexibility and efficiency of chemical processes.In summary, (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)oct-7-enoic acid, $name$, serves as a valuable building block in chemical synthesis, facilitating the construction of complex and chiral molecules with broad applications in pharmaceuticals, agrochemicals, and materials science.