AA35581
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98+% | in stock | $12.00 | $9.00 | - + | |
2mg | 98+% | in stock | $18.00 | $13.00 | - + | |
5mg | 98+% | in stock | $28.00 | $19.00 | - + | |
10mg | 98+% | in stock | $42.00 | $30.00 | - + | |
50mg | 98+% | in stock | $117.00 | $82.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA35581 |
Chemical Name: | 4H-[1,2,4]Triazolo[4,3-a][1,4]benzodiazepine-4-acetamide, 6-(4-chlorophenyl)-N-ethyl-8-methoxy-1-methyl-, (4S)- |
CAS Number: | 1260907-17-2 |
Molecular Formula: | C22H22ClN5O2 |
Molecular Weight: | 423.8954 |
MDL Number: | MFCD22417091 |
SMILES: | CCNC(=O)C[C@@H]1N=C(c2ccc(cc2)Cl)c2c(n3c1nnc3C)ccc(c2)OC |
Complexity: | 639 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 30 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 5 |
XLogP3: | 2.9 |
The Journal of biological chemistry 20180216
Oncogene 20170105
Endocrine-related cancer 20160401
The Journal of clinical investigation 20160201
Nature 20150924
Cell research 20140701
Molecular cancer therapeutics 20140501
Blood 20140130
ACS medicinal chemistry letters 20130912
Journal of medicinal chemistry 20130425
Nature 20120809
Bioorganic & medicinal chemistry letters 20120415
Journal of medicinal chemistry 20120126
Cell 20110916
Biochimica et biophysica acta 20110801
Journal of medicinal chemistry 20110609
Nature 20101223