AA36641
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 95% | in stock | $29.00 | $20.00 | - + | |
5mg | 95% | in stock | $62.00 | $43.00 | - + | |
10mg | 95% | in stock | $89.00 | $62.00 | - + | |
25mg | 95% | in stock | $120.00 | $84.00 | - + | |
50mg | 95% | in stock | $188.00 | $132.00 | - + | |
100mg | 95% | in stock | $306.00 | $215.00 | - + | |
250mg | 95% | in stock | $448.00 | $314.00 | - + | |
1g | 95% | in stock | $1,100.00 | $770.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA36641 |
Chemical Name: | 6-(4-(Trifluoromethoxy)phenyl)-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridine |
CAS Number: | 1262618-39-2 |
Molecular Formula: | C14H7F6N3O |
Molecular Weight: | 347.21529919999995 |
MDL Number: | MFCD28385879 |
SMILES: | FC(Oc1ccc(cc1)c1ccc2n(c1)c(nn2)C(F)(F)F)(F)F |
Complexity: | 435 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 24 |
Hydrogen Bond Acceptor Count: | 9 |
Rotatable Bond Count: | 2 |
XLogP3: | 4.9 |
British journal of pharmacology 20180601
Bioorganic & medicinal chemistry letters 20160701
Journal of agricultural and food chemistry 19760101