AA36933
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $10.00 | $7.00 | - + | |
250mg | 95% | in stock | $13.00 | $9.00 | - + | |
1g | 95% | in stock | $42.00 | $30.00 | - + | |
5g | 95% | in stock | $208.00 | $146.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA36933 |
Chemical Name: | N-(tert-Butoxycarbonyl)-D-serine beta-lactone |
CAS Number: | 126330-77-6 |
Molecular Formula: | C8H13NO4 |
Molecular Weight: | 187.1931 |
MDL Number: | MFCD11519129 |
SMILES: | O=C(OC(C)(C)C)N[C@@H]1COC1=O |
Complexity: | 231 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
XLogP3: | 0.7 |
Journal of medicinal chemistry 20120524