AD29948
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 98% | in stock | $9.00 | $6.00 | - + | |
10g | 98% | in stock | $16.00 | $11.00 | - + | |
25g | 98% | in stock | $21.00 | $15.00 | - + | |
100g | 98% | in stock | $66.00 | $47.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD29948 |
Chemical Name: | (1S,2R)-(-)-Cis-1-amino-2-indanol |
CAS Number: | 126456-43-7 |
Molecular Formula: | C9H11NO |
Molecular Weight: | 149.1897 |
MDL Number: | MFCD00216655 |
SMILES: | N[C@@H]1[C@H](O)Cc2c1cccc2 |
Complexity: | 149 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 2 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 2 |
XLogP3: | 0.2 |
Organic letters 20120203
Biotechnology and bioengineering 20060205
Bioorganic & medicinal chemistry letters 20020107
Journal of medicinal chemistry 20011011