AA37850
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
2mg | 98% | in stock | $19.00 | $13.00 | - + | |
100mg | 98% | in stock | $176.00 | $123.00 | - + | |
250mg | 98% | in stock | $299.00 | $209.00 | - + | |
1g | 98% | in stock | $962.00 | $674.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA37850 |
Chemical Name: | 6H-Thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepine-6-acetic acid, 4-(4-chlorophenyl)-2,3,9-trimethyl-, 1,1-dimethylethyl ester, (6R)- |
CAS Number: | 1268524-71-5 |
Molecular Formula: | C23H25ClN4O2S |
Molecular Weight: | 456.9882 |
MDL Number: | MFCD22124456 |
SMILES: | O=C(OC(C)(C)C)C[C@H]1N=C(c2ccc(cc2)Cl)c2c(-n3c1nnc3C)sc(c2C)C |
Complexity: | 706 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 31 |
Hydrogen Bond Acceptor Count: | 6 |
Rotatable Bond Count: | 5 |
XLogP3: | 4.9 |
The (R)-(-)-tert-Butyl 2-(4-(4-chlorophenyl)-2,3,9-trimethyl-6H-thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepin-6-yl)acetate compound is widely utilized in chemical synthesis processes due to its unique structural properties. Specifically, it serves as a valuable building block in the creation of novel pharmaceuticals, agrochemicals, and materials. With its intricate molecular design, this compound facilitates the development of diverse organic compounds through strategic synthetic pathways. Its incorporation in chemical synthesis endeavors contributes to the production of innovative and potentially impactful substances for various industrial applications.