logo
Home  > Inhibitors/Agonists  > Natural Products  > Other Natural Product  > Vitamin A Acetate

AA41951

127-47-9 | Vitamin A Acetate

Packsize Purity Availability Price Discounted Price    Quantity
100mg 2800000% in stock $15.00 $10.00 -   +
1g 2800000% in stock $18.00 $12.00 -   +
5g 2800000% in stock $28.00 $20.00 -   +
10g 2800000% in stock $36.00 $25.00 -   +
25g 2800000% in stock $43.00 $30.00 -   +
100g 2800000% in stock $126.00 $89.00 -   +
500g 2800000% in stock $460.00 $322.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA41951
Chemical Name: Vitamin A Acetate
CAS Number: 127-47-9
Molecular Formula: C22H32O2
Molecular Weight: 328.4883
MDL Number: MFCD00019413
SMILES: CC(=O)OC/C=C(/C=C/C=C(/C=C/C1=C(C)CCCC1(C)C)C)C

 

Computed Properties
Complexity: 596  
Covalently-Bonded Unit Count: 1  
Defined Bond Stereocenter Count: 4  
Heavy Atom Count: 24  
Hydrogen Bond Acceptor Count: 2  
Rotatable Bond Count: 7  
XLogP3: 6.3  

 

 

Upstream Synthesis Route
  • Retinol acetate, a derivative of vitamin A, serves as a valuable tool in chemical synthesis due to its versatile applications. In organic synthesis, Retinol acetate can act as a precursor or reagent in the preparation of various compounds. Its reactivity allows for the modification of chemical structures, leading to the creation of new molecules with desired properties. Retinol acetate's presence can facilitate the formation of complex organic molecules through processes such as esterification, acylation, and reduction reactions. Additionally, Retinol acetate can be utilized in the synthesis of pharmaceuticals, cosmetics, and other specialty chemicals where its unique properties play a crucial role in the development of innovative products. Its ability to undergo diverse chemical transformations makes Retinol acetate an indispensable component in the realm of chemical synthesis.
Literature
FEATURED PRODUCTS