AA42856
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $48.00 | $34.00 | - + | |
5mg | 98% | in stock | $112.00 | $78.00 | - + | |
10mg | 98% | in stock | $178.00 | $124.00 | - + | |
25mg | 98% | in stock | $330.00 | $231.00 | - + | |
50mg | 98% | in stock | $532.00 | $372.00 | - + | |
100mg | 98% | in stock | $690.00 | $483.00 | - + | |
250mg | 98% | in stock | $898.00 | $628.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA42856 |
Chemical Name: | HS-173 |
CAS Number: | 1276110-06-5 |
Molecular Formula: | C21H18N4O4S |
Molecular Weight: | 422.457 |
MDL Number: | MFCD28023584 |
SMILES: | CCOC(=O)c1cnc2n1cc(cc2)c1cncc(c1)NS(=O)(=O)c1ccccc1 |
Complexity: | 692 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 30 |
Hydrogen Bond Acceptor Count: | 7 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 7 |
XLogP3: | 3.4 |
Cancer letters 20130101
Scientific reports 20130101
Journal of medicinal chemistry 20110414