AA43177
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | ≥98% | in stock | $15.00 | $10.00 | - + | |
5g | 95% | in stock | $17.00 | $12.00 | - + | |
25g | 95% | in stock | $33.00 | $23.00 | - + | |
100g | 98% | in stock | $106.00 | $75.00 | - + | |
500g | 98% | in stock | $387.00 | $271.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA43177 |
Chemical Name: | (R)-1-[3,5-Bis(trifluoromethyl)phenyl]ethanol |
CAS Number: | 127852-28-2 |
Molecular Formula: | C10H8F6O |
Molecular Weight: | 258.1603 |
MDL Number: | MFCD03093010 |
SMILES: | C[C@H](c1cc(cc(c1)C(F)(F)F)C(F)(F)F)O |
Complexity: | 237 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 7 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 1 |
XLogP3: | 3.2 |
Applied microbiology and biotechnology 20110601