AA38270
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $9.00 | $7.00 | - + | |
500mg | 97% | in stock | $16.00 | $11.00 | - + | |
1g | 97% | in stock | $28.00 | $19.00 | - + | |
5g | 97% | in stock | $76.00 | $53.00 | - + | |
10g | 97% | in stock | $142.00 | $99.00 | - + | |
25g | 97% | in stock | $283.00 | $198.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA38270 |
Chemical Name: | ethyl 5-(trifluoromethyl)-2H-pyrazole-3-carboxylate |
CAS Number: | 129768-30-5 |
Molecular Formula: | C7H7F3N2O2 |
Molecular Weight: | 208.1379 |
MDL Number: | MFCD04111238 |
SMILES: | CCOC(=O)c1cc([nH]n1)C(F)(F)F |
Ethyl 5-Trifluoromethyl-1H-pyrazole-3-carboxylate is a versatile compound that has gained significant attention in chemical synthesis due to its unique properties and reactivity. In the realm of organic chemistry, this compound serves as a valuable building block for the synthesis of various pharmaceutically and industrially important molecules.One of the key applications of Ethyl 5-Trifluoromethyl-1H-pyrazole-3-carboxylate is its use as a precursor in the synthesis of heterocyclic compounds. By incorporating this compound into reactions, chemists can access a diverse array of pyrazole derivatives, which have proven to be crucial in drug discovery and development.Additionally, Ethyl 5-Trifluoromethyl-1H-pyrazole-3-carboxylate can be utilized in transition metal-catalyzed cross-coupling reactions to introduce the trifluoromethyl group into organic molecules. This functional group is highly sought after in medicinal chemistry due to its ability to modulate the pharmacokinetic properties of drug candidates.Furthermore, the presence of the ester group in Ethyl 5-Trifluoromethyl-1H-pyrazole-3-carboxylate enables chemists to facilely manipulate its structure through various chemical transformations. This flexibility opens up avenues for the development of new synthetic methodologies and the rapid diversification of compound libraries for biological screening.Overall, Ethyl 5-Trifluoromethyl-1H-pyrazole-3-carboxylate is a valuable compound in chemical synthesis, offering chemists a powerful tool for accessing diverse molecular architectures with potential applications in drug discovery, materials science, and beyond.