AA39155
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $39.00 | $27.00 | - + | |
1g | 97% | in stock | $42.00 | $30.00 | - + | |
5g | 97% | in stock | $55.00 | $39.00 | - + | |
10g | 97% | in stock | $110.00 | $77.00 | - + | |
25g | 97% | in stock | $178.00 | $125.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA39155 |
Chemical Name: | Methyl D-ribofuranoside(α and β mixture) |
CAS Number: | 13039-63-9 |
Molecular Formula: | C6H12O5 |
Molecular Weight: | 164.1565 |
MDL Number: | MFCD23704944 |
SMILES: | COC1O[C@@H]([C@H]([C@H]1O)O)CO |