logo
Home  > Trans-4-methylcyclohexanecarboxylic acid

AA39648

13064-83-0 | Trans-4-methylcyclohexanecarboxylic acid

Packsize Purity Availability Price Discounted Price    Quantity
250mg 97% in stock $15.00 $10.00 -   +
1g 97% in stock $16.00 $11.00 -   +
5g 97% in stock $25.00 $17.00 -   +
25g 97% in stock $40.00 $28.00 -   +
100g 97% in stock $106.00 $75.00 -   +
500g 97% in stock $387.00 $271.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA39648
Chemical Name: Trans-4-methylcyclohexanecarboxylic acid
CAS Number: 13064-83-0
Molecular Formula: C8H14O2
Molecular Weight: 142.1956
MDL Number: MFCD00074943
SMILES: C[C@@H]1CC[C@H](CC1)C(=O)O
NSC Number: 124039

 

Computed Properties
Complexity: 123  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 10  
Hydrogen Bond Acceptor Count: 2  
Hydrogen Bond Donor Count: 1  
Rotatable Bond Count: 1  
XLogP3: 2.1  

 

 

Upstream Synthesis Route
  • Trans-4-Methylcyclohexanecarboxylic acid, also known as TMCCA, is a versatile compound commonly utilized in chemical synthesis processes. This acid derivative plays a crucial role as a building block in the creation of various pharmaceuticals, agrochemicals, and specialty chemicals. It serves as a key intermediate in the synthesis of complex organic molecules due to its unique structural properties and reactivity. In chemical synthesis, trans-4-Methylcyclohexanecarboxylic acid is often employed for its ability to undergo diverse transformations, such as esterification, amidation, and hydrogenation reactions, leading to the formation of new compounds with distinct properties and functionalities. Additionally, its stereochemistry can be controlled to generate enantiomerically pure products, making it a valuable tool for the production of chiral molecules in asymmetric synthesis. The application of trans-4-Methylcyclohexanecarboxylic acid in chemical synthesis exemplifies its significance as a versatile and indispensable reagent for the development and optimization of innovative chemical processes.
FEATURED PRODUCTS