AE33022
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $15.00 | $10.00 | - + | |
100mg | 98% | in stock | $23.00 | $16.00 | - + | |
250mg | 98% | in stock | $36.00 | $25.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE33022 |
Chemical Name: | PHTHALYLSULFACETAMIDE |
CAS Number: | 131-69-1 |
Molecular Formula: | C16H14N2O6S |
Molecular Weight: | 362.3572 |
MDL Number: | MFCD00020275 |
SMILES: | CC(=O)NS(=O)(=O)c1ccc(cc1)NC(=O)c1ccccc1C(=O)O |
Complexity: | 619 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 25 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 5 |
XLogP3: | 1 |
Frontiers in psychology 20120101
Bioorganic & medicinal chemistry letters 20101101
PLoS biology 20080501
Antimicrobial agents and chemotherapy 19980601
Antimicrobial agents and chemotherapy 19950801