AA41316
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $89.00 | $62.00 | - + | |
5g | 95% | in stock | $183.00 | $129.00 | - + | |
10g | 95% | in stock | $304.00 | $213.00 | - + | |
25g | 95% | in stock | $535.00 | $375.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA41316 |
Chemical Name: | Methyl 3-azetidineacetate trifluoroacetate salt |
CAS Number: | 1313738-62-3 |
Molecular Formula: | C8H12F3NO4 |
Molecular Weight: | 243.18038959999996 |
MDL Number: | MFCD18425634 |
SMILES: | OC(=O)C(F)(F)F.COC(=O)CC1CNC1 |
Complexity: | 193 |
Covalently-Bonded Unit Count: | 2 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 8 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 3 |
Methyl 2-(azetidin-3-yl)acetate 2,2,2-trifluoroacetate serves as a versatile building block in chemical synthesis, particularly for the preparation of complex organic molecules. This compound is commonly employed in the synthesis of pharmaceutical intermediates, agrochemicals, and materials science. Its unique structure and reactivity make it a valuable tool for chemists seeking to access diverse molecular architectures with high control over stereochemistry. By incorporating Methyl 2-(azetidin-3-yl)acetate 2,2,2-trifluoroacetate into synthetic routes, chemists can efficiently introduce functional groups and stereogenic centers, enabling the creation of novel compounds with potential applications in drug discovery, materials design, and other fields.