AE35808
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5mg | ≥98% | in stock | $48.00 | $34.00 | - + | |
10mg | ≥98% | in stock | $88.00 | $62.00 | - + | |
25mg | ≥98% | in stock | $150.00 | $105.00 | - + | |
50mg | ≥98% | in stock | $207.00 | $145.00 | - + | |
500mg | 98% | in stock | $1,697.00 | $1,188.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE35808 |
Chemical Name: | Unc 669 |
CAS Number: | 1314241-44-5 |
Molecular Formula: | C15H20BrN3O |
Molecular Weight: | 338.2428 |
MDL Number: | MFCD26936345 |
SMILES: | Brc1cncc(c1)C(=O)N1CCC(CC1)N1CCCC1 |
Complexity: | 338 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 20 |
Hydrogen Bond Acceptor Count: | 3 |
Rotatable Bond Count: | 2 |
XLogP3: | 2.1 |
Journal of medicinal chemistry 20110414