AA45843
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $10.00 | $7.00 | - + | |
1g | 95% | in stock | $17.00 | $12.00 | - + | |
5g | 97% | in stock | $23.00 | $17.00 | - + | |
10g | 97% | in stock | $29.00 | $20.00 | - + | |
25g | 97% | in stock | $68.00 | $48.00 | - + | |
100g | 97% | in stock | $259.00 | $182.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA45843 |
Chemical Name: | 4,6-Dichloro-2-methyl-5-nitropyrimidine |
CAS Number: | 13162-43-1 |
Molecular Formula: | C5H3Cl2N3O2 |
Molecular Weight: | 208.0022 |
MDL Number: | MFCD00060527 |
SMILES: | Clc1nc(C)nc(c1[N+](=O)[O-])Cl |
Complexity: | 174 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 4 |
XLogP3: | 2.4 |
Journal of combinatorial chemistry 20050101