AA45874
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 95% | in stock | $41.00 | $29.00 | - + | |
10mg | 95% | in stock | $60.00 | $42.00 | - + | |
25mg | 95% | in stock | $130.00 | $91.00 | - + | |
50mg | 95% | in stock | $226.00 | $158.00 | - + | |
100mg | 95% | in stock | $430.00 | $301.00 | - + | |
250mg | 95% | in stock | $832.00 | $582.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA45874 |
Chemical Name: | (E)-3-(2-(1H-Tetrazol-5-yl)vinyl)-6-fluoro-1h-indole |
CAS Number: | 1316695-35-8 |
Molecular Formula: | C11H8FN5 |
Molecular Weight: | 229.2131 |
MDL Number: | MFCD26097257 |
SMILES: | Fc1ccc2c(c1)[nH]cc2/C=C/c1n[nH]nn1 |
Complexity: | 298 |
Covalently-Bonded Unit Count: | 1 |
Defined Bond Stereocenter Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 2 |
XLogP3: | 2 |
Proceedings of the National Academy of Sciences of the United States of America 20120214
Journal of medicinal chemistry 20110811