AA45964
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $12.00 | $9.00 | - + | |
5g | 98% | in stock | $30.00 | $21.00 | - + | |
25g | 98% | in stock | $105.00 | $73.00 | - + | |
100g | 98% | in stock | $287.00 | $201.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA45964 |
Chemical Name: | Celestolide |
CAS Number: | 13171-00-1 |
Molecular Formula: | C17H24O |
Molecular Weight: | 244.3719 |
MDL Number: | MFCD00046324 |
SMILES: | CC(=O)c1cc(cc2c1CCC2(C)C)C(C)(C)C |
Complexity: | 334 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 5 |
Analytical and bioanalytical chemistry 20120801
The Science of the total environment 20120201
The Science of the total environment 20120201
Journal of environmental science and health. Part A, Toxic/hazardous substances & environmental engineering 20120101
Analytical chemistry 20110615
Chemosphere 20110201
Aquatic toxicology (Amsterdam, Netherlands) 20110117
Environmental toxicology and chemistry 20100901
Analytical and bioanalytical chemistry 20100301
Environmental science & technology 20091215
Chemosphere 20071001
Chemosphere 20070101
Environmental sciences : an international journal of environmental physiology and toxicology 20070101
Marine environmental research 20040101
The Science of the total environment 20030415
Aquatic toxicology (Amsterdam, Netherlands) 20030410