AB53851
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 99% | in stock | $270.00 | $189.00 | - + | |
5mg | 99% | in stock | $1,143.00 | $800.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB53851 |
Chemical Name: | (2R,3aS,5aR,5bS,9S,13S,14R,16aS,16bR)-2-[(6-Deoxy-2,3,4-tri-O-methyl-α-L-mannopyranosyl)oxy]-13-[[(2R,5S,6R)-5-(dimethylamino)tetrahydro-6-methyl-2H-pyran-2-yl]oxy]-9-ethyl-2,3,3a,5a,5b,6,9,10,11,12,13,14,16a,16b-tetradecahydro-14-methyl-1H-as-indaceno[3,2-d]oxacyclododecin-7,15-dione |
CAS Number: | 131929-60-7 |
Molecular Formula: | C41H65NO10 |
Molecular Weight: | 731.9555 |
MDL Number: | MFCD01753923 |
SMILES: | CC[C@H]1CCC[C@H](O[C@H]2CC[C@@H]([C@H](O2)C)N(C)C)[C@@H](C)C(=O)C2=C[C@@H]3[C@H]([C@@H]2CC(=O)O1)C=C[C@H]1[C@H]3C[C@@H](C1)O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1OC)OC)OC |
The compound (2R,3aS,5aR,5bS,9S,13S,14R,16aS,16bR)-2-[(6-deoxy-2,3,4-tri-O-methyl-α-L-mannopyranosyl)oxy]-13-[[(2R,5S,6R)-5-(dimethylamino)tetrahydro-6-methyl-2H-pyran-2-yl]oxy]-9-ethyl-2,3,3a,5a,5b,6,9,10,11,12,13,14,16a,16b-tetradecahydro-14-methyl-1H-as-indaceno[3,2-d]oxacyclododecin-7,15-dione is commonly utilized in chemical synthesis for its ability to serve as a key building block in the creation of complex molecular structures. Its structural features make it a valuable tool in the construction of intricate organic compounds through strategic bond formations and stereochemical control. The compound's unique stereochemistry and functional groups enable precise manipulations that are essential for the synthesis of biologically active molecules, natural products, pharmaceutical intermediates, and other valuable chemical entities. Its application in chemical synthesis contributes to the advancement of medicinal chemistry, materials science, and other research fields that rely on innovative synthetic strategies for the creation of new compounds with diverse properties and functions.