AA46734
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98%(HPLCtotal) | in stock | $22.00 | $16.00 | - + | |
5g | 98%(HPLCtotal) | in stock | $31.00 | $22.00 | - + | |
25g | 98%(HPLCtotal) | in stock | $71.00 | $50.00 | - + | |
100g | 98%(mix of isomers) | in stock | $116.00 | $81.00 | - + | |
500g | 98%(mix of isomers) | in stock | $284.00 | $199.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA46734 |
Chemical Name: | Potassium guaiacolsulfonate |
CAS Number: | 1321-14-8 |
Molecular Formula: | C7H7KO5S |
Molecular Weight: | 242.2908 |
MDL Number: | MFCD00053298 |
SMILES: | OCOc1ccccc1S(=O)(=O)[O-].[K+] |