AA47087
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | in stock | $36.00 | $25.00 | - + | |
250mg | 98% | in stock | $65.00 | $45.00 | - + | |
1g | 98% | in stock | $150.00 | $105.00 | - + | |
5g | 98% | in stock | $566.00 | $396.00 | - + | |
10g | 98% | in stock | $945.00 | $661.00 | - + | |
25g | 98% | in stock | $1,878.00 | $1,315.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA47087 |
Chemical Name: | 2-(2-Pyridinyl)-1H-indole |
CAS Number: | 13228-40-5 |
Molecular Formula: | C13H10N2 |
Molecular Weight: | 194.2319 |
MDL Number: | MFCD00033466 |
SMILES: | c1ccc(nc1)c1cc2c([nH]1)cccc2 |
NSC Number: | 112668 |
Complexity: | 217 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 1 |
XLogP3: | 3.3 |
Dalton transactions (Cambridge, England : 2003) 20120128
Chemistry (Weinheim an der Bergstrasse, Germany) 20100426
The Journal of organic chemistry 20060414
Bioorganic chemistry 20060201
Bioorganic chemistry 20060201