AA47182
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 98% | in stock | $10.00 | $7.00 | - + | |
10g | 98% | in stock | $12.00 | $8.00 | - + | |
25g | 98% | in stock | $28.00 | $19.00 | - + | |
100g | 98% | in stock | $69.00 | $48.00 | - + | |
500g | 98% | in stock | $310.00 | $217.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA47182 |
Chemical Name: | Fmoc-Gln(Trt)-OH |
CAS Number: | 132327-80-1 |
Molecular Formula: | C39H34N2O5 |
Molecular Weight: | 610.6977 |
MDL Number: | MFCD00077056 |
SMILES: | NC(=O)CC[C@H](N(C(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)OCC1c2ccccc2-c2c1cccc2)C(=O)O |
Complexity: | 946 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 46 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 12 |
XLogP3: | 7 |
Fmoc-Gln(Trt)-OH, a derivative of glutamine amino acid, is a widely used building block in chemical synthesis processes. Primarily employed in solid-phase peptide synthesis, Fmoc-Gln(Trt)-OH serves as a key component in the creation of complex peptide sequences due to its unique reactivity and compatibility with various coupling reagents and protecting groups. Its Fmoc (9-fluorenylmethyloxycarbonyl) protecting group enables selective deprotection under mild conditions, facilitating sequential addition of amino acids while preventing undesired side reactions. Additionally, the Trt (trityl) protecting group offers enhanced stability during peptide assembly, ensuring high yields and purity of the final product. Overall, Fmoc-Gln(Trt)-OH is essential for the efficient and precise synthesis of peptides for various biomedical, pharmaceutical, and chemical research applications.