AX46913
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
2mg | 98% | in stock | $27.00 | $19.00 | - + | |
5mg | 98% | in stock | $64.00 | $45.00 | - + | |
25mg | 98% | in stock | $233.00 | $163.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AX46913 |
Chemical Name: | CC-220 |
CAS Number: | 1323403-33-3 |
Molecular Formula: | C25H27N3O5 |
Molecular Weight: | 449.4990 |
MDL Number: | MFCD31382133 |
SMILES: | O=C1CC[C@@H](C(=O)N1)N1Cc2c(C1=O)cccc2OCc1ccc(cc1)CN1CCOCC1 |
Complexity: | 732 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 33 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 6 |
XLogP3: | 1.1 |
Journal of medicinal chemistry 20180125
Blood cancer journal 20151001
PloS one 20140101