AA48232
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98%;RG | 2 weeks | $23.00 | $16.00 | - + | |
250mg | 98%;RG | 2 weeks | $33.00 | $23.00 | - + | |
500mg | 95% | 2 weeks | $41.00 | $29.00 | - + | |
1g | 95% | 2 weeks | $55.00 | $39.00 | - + | |
2g | 95% | 2 weeks | $91.00 | $64.00 | - + | |
5g | 95% | 2 weeks | $200.00 | $140.00 | - + | |
10g | 95% | 2 weeks | $384.00 | $269.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA48232 |
Chemical Name: | 8-Bromo-2,3,4,9-tetrahydro-1h-carbazol-1-one |
CAS Number: | 132906-53-7 |
Molecular Formula: | C12H10BrNO |
Molecular Weight: | 264.1179 |
MDL Number: | MFCD02053395 |
SMILES: | O=C1CCCc2c1[nH]c1c2cccc1Br |
Complexity: | 281 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 1 |
XLogP3: | 3.2 |
Cytometry. Part A : the journal of the International Society for Analytical Cytology 20060501