AA48265
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $50.00 | $35.00 | - + | |
500mg | ≥95% | in stock | $63.00 | $45.00 | - + | |
1g | 95% | in stock | $100.00 | $70.00 | - + | |
5g | 95% | in stock | $400.00 | $280.00 | - + | |
25g | 95% | in stock | $1,608.00 | $1,125.00 | - + | |
100g | 95% | in stock | $3,422.00 | $2,395.00 | - + | |
500g | 95% | in stock | $7,136.00 | $4,995.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA48265 |
Chemical Name: | 3-Formyl rifamycin sv |
CAS Number: | 13292-22-3 |
Molecular Formula: | C38H47NO13 |
Molecular Weight: | 725.7787 |
MDL Number: | MFCD01729454 |
SMILES: | CO[C@H]1/C=C/O[C@@]2(C)Oc3c(C2=O)c2c(O)c(C=O)c(c(c2c(c3C)O)O)NC(=O)/C(=C\C=C\[C@@H]([C@@H]([C@H]([C@H]([C@H]([C@@H]([C@@H]1C)OC(=O)C)C)O)C)O)C)/C |
Complexity: | 1410 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 9 |
Defined Bond Stereocenter Count: | 3 |
Heavy Atom Count: | 52 |
Hydrogen Bond Acceptor Count: | 13 |
Hydrogen Bond Donor Count: | 6 |
Rotatable Bond Count: | 4 |
XLogP3: | 4.9 |
Experientia 19680315
Antimicrobial agents and chemotherapy 19650101