AA52426
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $8.00 | $5.00 | - + | |
5g | 98% | in stock | $10.00 | $7.00 | - + | |
10g | 98% | in stock | $18.00 | $12.00 | - + | |
25g | 98% | in stock | $33.00 | $23.00 | - + | |
100g | 98% | in stock | $36.00 | $25.00 | - + | |
500g | 98% | in stock | $178.00 | $124.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA52426 |
Chemical Name: | 3-Nitrophenylboronic acid |
CAS Number: | 13331-27-6 |
Molecular Formula: | C6H6BNO4 |
Molecular Weight: | 166.9271 |
MDL Number: | MFCD00007193 |
SMILES: | OB(c1cccc(c1)[N+](=O)[O-])O |
Complexity: | 169 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 1 |
3-Nitrophenylboronic acid is a versatile compound widely used in chemical synthesis for its unique properties. This compound serves as a key building block in organic chemistry, specifically in the field of cross-coupling reactions. By forming stable boronate esters with aryl halides or triflates, 3-Nitrophenylboronic acid facilitates the creation of complex molecular structures. Additionally, it is employed in the synthesis of pharmaceuticals, agrochemicals, and materials science due to its ability to act as a valuable intermediate in various transformations. With its strategic role in the production of diverse compounds, 3-Nitrophenylboronic acid continues to be a valuable asset in the realm of chemical synthesis.
Journal of agricultural and food chemistry 20111109
Analytical and bioanalytical chemistry 20101001
Antiviral chemistry & chemotherapy 20100811
Bioorganic & medicinal chemistry letters 20100601
Chemical communications (Cambridge, England) 20100407
Journal of medicinal chemistry 20091008
Neuroscience letters 20081017
Inorganic chemistry 20080303
Chemical communications (Cambridge, England) 20080121
Angewandte Chemie (International ed. in English) 20080101
Organic & biomolecular chemistry 20040521
Bioorganic & medicinal chemistry letters 20040105
The Prostate 20030101
Journal of medicinal chemistry 20020718
Journal of combinatorial chemistry 20020101