AD56764
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $21.00 | $15.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD56764 |
Chemical Name: | Benzyl 2-acetamido-2-deoxy-alpha-d-glucopyranoside |
CAS Number: | 13343-62-9 |
Molecular Formula: | C15H21NO6 |
Molecular Weight: | 311.3303 |
MDL Number: | MFCD00070371 |
SMILES: | OC[C@H]1O[C@H](OCc2ccccc2)[C@@H]([C@H]([C@@H]1O)O)NC(=O)C |
Complexity: | 360 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 5 |
Heavy Atom Count: | 22 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 4 |
Rotatable Bond Count: | 5 |
XLogP3: | -0.7 |
Journal of medicinal chemistry 20070125