AE35690
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
2mg | 98% | in stock | $23.00 | $17.00 | - + | |
5mg | 98% | in stock | $35.00 | $25.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE35690 |
Chemical Name: | Gsk2606414 |
CAS Number: | 1337531-36-8 |
Molecular Formula: | C24H20F3N5O |
Molecular Weight: | 451.4437 |
MDL Number: | MFCD25976926 |
SMILES: | O=C(N1CCc2c1ccc(c2)c1cn(c2c1c(N)ncn2)C)Cc1cccc(c1)C(F)(F)F |
Complexity: | 721 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 33 |
Hydrogen Bond Acceptor Count: | 7 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
XLogP3: | 3.8 |
BMC gastroenterology 20160101
ACS medicinal chemistry letters 20131010
Science translational medicine 20131009
Journal of medicinal chemistry 20120823