AD72997
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $26.00 | $18.00 | - + | |
5g | 98% | in stock | $49.00 | $34.00 | - + | |
25g | 98% | in stock | $131.00 | $92.00 | - + | |
100g | 98% | in stock | $387.00 | $271.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD72997 |
Chemical Name: | 6,6'-Ureylene-bis(1-naphthol-3-sulfonic acid) |
CAS Number: | 134-47-4 |
Molecular Formula: | C21H16N2O9S2 |
Molecular Weight: | 504.4897 |
MDL Number: | MFCD00035715 |
SMILES: | O=C(Nc1ccc2c(c1)cc(cc2O)S(=O)(=O)O)Nc1ccc2c(c1)cc(cc2O)S(=O)(=O)O |
Complexity: | 886 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 34 |
Hydrogen Bond Acceptor Count: | 9 |
Hydrogen Bond Donor Count: | 6 |
Rotatable Bond Count: | 4 |
XLogP3: | 1.8 |
Journal of medicinal chemistry 20100826
Journal of medicinal chemistry 20100422
Retrovirology 20060101
The Journal of biological chemistry 20040604
Bioorganic chemistry 20021201
Bioorganic chemistry 20000601