AW05159
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
50mg | 95% | 1 week | $673.00 | $471.00 | - + | |
100mg | 95% | 1 week | $965.00 | $676.00 | - + | |
250mg | 95% | 1 week | $1,347.00 | $943.00 | - + | |
500mg | 95% | 1 week | $2,072.00 | $1,451.00 | - + | |
1g | 95% | 1 week | $2,635.00 | $1,845.00 | - + | |
2.5g | 95% | 1 week | $5,086.00 | $3,560.00 | - + | |
5g | 95% | 1 week | $7,488.00 | $5,242.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AW05159 |
Chemical Name: | 1-(3-chlorophenyl)-3-methylcyclobutane-1-carboxylic acid, Mixture of isomers |
CAS Number: | 1340521-86-9 |
Molecular Formula: | C12H13ClO2 |
Molecular Weight: | 224.6834 |
MDL Number: | MFCD19683115 |
SMILES: | CC1CC(C1)(C(=O)O)c1cccc(c1)Cl |