AD54194
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $355.00 | $248.00 | - + | |
1g | 98% | in stock | $867.00 | $607.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD54194 |
Chemical Name: | 3-Hydroxy-2-(4-hydroxy-3-methoxyphenyl)-6,7-dimethylchromen-4-one |
CAS Number: | 1353223-95-6 |
Molecular Formula: | C18H16O5 |
Molecular Weight: | 312.3166 |
MDL Number: | MFCD22192464 |
SMILES: | COc1cc(ccc1O)c1oc2cc(C)c(cc2c(=O)c1O)C |
Complexity: | 500 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 23 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 2 |
XLogP3: | 3.4 |
Journal of medicinal chemistry 20120112