AE62734
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $789.00 | $553.00 | - + | |
250mg | 95% | in stock | $1,535.00 | $1,074.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE62734 |
Chemical Name: | 3-Hydroxy-2-[3-hydroxy-4-(pyrrolidin-1-yl)phenyl]benzo[h]chromen-4-one |
CAS Number: | 1353224-63-1 |
Molecular Formula: | C23H19NO4 |
Molecular Weight: | 373.4013 |
MDL Number: | MFCD22192466 |
SMILES: | Oc1cc(ccc1N1CCCC1)c1oc2c(c(=O)c1O)ccc1c2cccc1 |
Complexity: | 641 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 28 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 2 |
XLogP3: | 4.5 |
Journal of medicinal chemistry 20120112