AI32085
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 97% | in stock | $59.00 | $42.00 | - + | |
250mg | 97% | in stock | $86.00 | $60.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI32085 |
Chemical Name: | Propargyl-peg4-t-butyl ester |
CAS Number: | 1355197-66-8 |
Molecular Formula: | C16H28O6 |
Molecular Weight: | 316.38992 |
MDL Number: | MFCD22683285 |
SMILES: | C#CCOCCOCCOCCOCCC(=O)OC(C)(C)C |
Complexity: | 325 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 22 |
Hydrogen Bond Acceptor Count: | 6 |
Rotatable Bond Count: | 15 |
XLogP3: | 0.6 |
4,7,10,13-Tetraoxahexadec-15-ynoic acid, 1,1-dimethylethyl ester is a versatile compound widely utilized in chemical synthesis for its unique properties and diverse applications. This compound acts as a valuable building block in organic synthesis, specifically in the formation of complex molecules and the modification of functional groups. Its alkyne functionality enables it to participate in various organic reactions, such as Sonogashira cross-coupling reactions, click chemistry, and oxidative transformations. Additionally, the ester group provides stability during reactions while also offering an opportunity for further derivatization. Due to its flexible nature and reactivity, this compound plays a crucial role in the preparation of pharmaceutical intermediates, materials science, and the production of specialty chemicals.