AB70477
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5mg | 98% | in stock | $29.00 | $20.00 | - + | |
10mg | 98% | in stock | $45.00 | $32.00 | - + | |
25mg | 98% | in stock | $58.00 | $41.00 | - + | |
50mg | 98% | in stock | $70.00 | $49.00 | - + | |
100mg | 98% | in stock | $106.00 | $74.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB70477 |
Chemical Name: | Agi-5198 |
CAS Number: | 1355326-35-0 |
Molecular Formula: | C27H31FN4O2 |
Molecular Weight: | 462.559 |
MDL Number: | MFCD24848688 |
SMILES: | Fc1cccc(c1)N(C(c1ccccc1C)C(=O)NC1CCCCC1)C(=O)Cn1ccnc1C |
Complexity: | 686 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 34 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 7 |
Undefined Atom Stereocenter Count: | 1 |
XLogP3: | 4.9 |
Oncotarget 20150520
The Journal of biological chemistry 20150109
Science (New York, N.Y.) 20130503