AA49215
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $15.00 | $10.00 | - + | |
1g | 98% | in stock | $15.00 | $11.00 | - + | |
5g | 95% | in stock | $54.00 | $38.00 | - + | |
25g | 95% | in stock | $185.00 | $130.00 | - + | |
100g | 95% | in stock | $692.00 | $484.00 | - + | |
500g | 97% | in stock | $2,625.00 | $1,837.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA49215 |
Chemical Name: | Fmoc-3-nitro-L-tyrosine |
CAS Number: | 136590-09-5 |
Molecular Formula: | C24H20N2O7 |
Molecular Weight: | 448.4248 |
MDL Number: | MFCD00171383 |
SMILES: | O=C(N[C@H](C(=O)O)Cc1ccc(c(c1)[N+](=O)[O-])O)OCC1c2ccccc2c2c1cccc2 |
Complexity: | 704 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 33 |
Hydrogen Bond Acceptor Count: | 7 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 7 |
XLogP3: | 4.7 |
International journal of molecular sciences 20110101